C11H14FNO2 — CID 64795167
N-(2-fluoro-4-hydroxyphenyl)-2,2-dimethylpropanamide (PubChem CID 64795167) has the molecular formula C11H14FNO2 and a molecular weight of 211.24 g/mol. Its IUPAC name is N-(2-fluoro-4-hydroxyphenyl)-2,2-dimethylpropanamide.
| Compound Name | N-(2-fluoro-4-hydroxyphenyl)-2,2-dimethylpropanamide |
|---|---|
| PubChem CID | 64795167 |
| Molecular Formula | C11H14FNO2 |
| Molecular Weight | 211.24 g/mol |
| Exact Mass | 211.10 |
| IUPAC Name | N-(2-fluoro-4-hydroxyphenyl)-2,2-dimethylpropanamide |
| SMILES | CC(C)(C)C(=O)Nc1ccc(O)cc1F |
| InChI | InChI=1S/C11H14FNO2/c1-11(2,3)10(15)13-9-5-4-7(14)6-8(9)12/h4-6,14H,1-3H3,(H,13,15) |
| InChIKey | DKHASFYGUUDZOS-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.24 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|