C17H18F2N2O — CID 112989406
N-[4-(2,4-difluoroanilino)phenyl]-2,2-dimethylpropanamide (PubChem CID 112989406) has the molecular formula C17H18F2N2O and a molecular weight of 304.34 g/mol. Its IUPAC name is N-[4-(2,4-difluoroanilino)phenyl]-2,2-dimethylpropanamide.
| Compound Name | N-[4-(2,4-difluoroanilino)phenyl]-2,2-dimethylpropanamide |
|---|---|
| PubChem CID | 112989406 |
| Molecular Formula | C17H18F2N2O |
| Molecular Weight | 304.34 g/mol |
| Exact Mass | 304.14 |
| IUPAC Name | N-[4-(2,4-difluoroanilino)phenyl]-2,2-dimethylpropanamide |
| SMILES | CC(C)(C)C(=O)Nc1ccc(Nc2ccc(F)cc2F)cc1 |
| InChI | InChI=1S/C17H18F2N2O/c1-17(2,3)16(22)21-13-7-5-12(6-8-13)20-15-9-4-11(18)10-14(15)19/h4-10,20H,1-3H3,(H,21,22) |
| InChIKey | UTDDDUDUNGFTJL-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.34 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |