C18H15F2N3O2 — CID 108970065
N-(4-cyanophenyl)-N'-(2,4-difluorophenyl)-2,2-dimethylpropanediamide (PubChem CID 108970065) has the molecular formula C18H15F2N3O2 and a molecular weight of 343.33 g/mol. Its IUPAC name is N-(4-cyanophenyl)-N'-(2,4-difluorophenyl)-2,2-dimethylpropanediamide.
| Compound Name | N-(4-cyanophenyl)-N'-(2,4-difluorophenyl)-2,2-dimethylpropanediamide |
|---|---|
| PubChem CID | 108970065 |
| Molecular Formula | C18H15F2N3O2 |
| Molecular Weight | 343.33 g/mol |
| Exact Mass | 343.11 |
| IUPAC Name | N-(4-cyanophenyl)-N'-(2,4-difluorophenyl)-2,2-dimethylpropanediamide |
| SMILES | CC(C)(C(=O)Nc1ccc(C#N)cc1)C(=O)Nc1ccc(F)cc1F |
| InChI | InChI=1S/C18H15F2N3O2/c1-18(2,16(24)22-13-6-3-11(10-21)4-7-13)17(25)23-15-8-5-12(19)9-14(15)20/h3-9H,1-2H3,(H,22,24)(H,23,25) |
| InChIKey | LGSKBPJAYUDUCF-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 81.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.33 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|