C12H16FNO — CID 63235993
N-(4-fluoro-3-methylphenyl)-2,2-dimethylpropanamide (PubChem CID 63235993) has the molecular formula C12H16FNO and a molecular weight of 209.26 g/mol. Its IUPAC name is N-(4-fluoro-3-methylphenyl)-2,2-dimethylpropanamide.
| Compound Name | N-(4-fluoro-3-methylphenyl)-2,2-dimethylpropanamide |
|---|---|
| PubChem CID | 63235993 |
| Molecular Formula | C12H16FNO |
| Molecular Weight | 209.26 g/mol |
| Exact Mass | 209.12 |
| IUPAC Name | N-(4-fluoro-3-methylphenyl)-2,2-dimethylpropanamide |
| SMILES | Cc1cc(NC(=O)C(C)(C)C)ccc1F |
| InChI | InChI=1S/C12H16FNO/c1-8-7-9(5-6-10(8)13)14-11(15)12(2,3)4/h5-7H,1-4H3,(H,14,15) |
| InChIKey | LIODOMHKEOBZMH-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.26 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |