C14H16FNO3 — CID 104781376
(E)-3-[5-(2,2-dimethylpropanoylamino)-2-fluorophenyl]prop-2-enoic acid (PubChem CID 104781376) has the molecular formula C14H16FNO3 and a molecular weight of 265.28 g/mol. Its IUPAC name is (E)-3-[5-(2,2-dimethylpropanoylamino)-2-fluorophenyl]prop-2-enoic acid.
| Compound Name | (E)-3-[5-(2,2-dimethylpropanoylamino)-2-fluorophenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 104781376 |
| Molecular Formula | C14H16FNO3 |
| Molecular Weight | 265.28 g/mol |
| Exact Mass | 265.11 |
| IUPAC Name | (E)-3-[5-(2,2-dimethylpropanoylamino)-2-fluorophenyl]prop-2-enoic acid |
| SMILES | CC(C)(C)C(=O)Nc1ccc(F)c(/C=C/C(=O)O)c1 |
| InChI | InChI=1S/C14H16FNO3/c1-14(2,3)13(19)16-10-5-6-11(15)9(8-10)4-7-12(17)18/h4-8H,1-3H3,(H,16,19)(H,17,18)/b7-4+ |
| InChIKey | CXBIUTVZTIKSGM-QPJJXVBHSA-N |
| XLogP | 2.91 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.28 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|