C15H16FNO4 — CID 114827205
(E)-3-[2-fluoro-5-[(5-methyloxolane-3-carbonyl)amino]phenyl]prop-2-enoic acid (PubChem CID 114827205) has the molecular formula C15H16FNO4 and a molecular weight of 293.29 g/mol. Its IUPAC name is (E)-3-[2-fluoro-5-[(5-methyloxolane-3-carbonyl)amino]phenyl]prop-2-enoic acid.
| Compound Name | (E)-3-[2-fluoro-5-[(5-methyloxolane-3-carbonyl)amino]phenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 114827205 |
| Molecular Formula | C15H16FNO4 |
| Molecular Weight | 293.29 g/mol |
| Exact Mass | 293.11 |
| IUPAC Name | (E)-3-[2-fluoro-5-[(5-methyloxolane-3-carbonyl)amino]phenyl]prop-2-enoic acid |
| SMILES | CC1CC(C(=O)Nc2ccc(F)c(/C=C/C(=O)O)c2)CO1 |
| InChI | InChI=1S/C15H16FNO4/c1-9-6-11(8-21-9)15(20)17-12-3-4-13(16)10(7-12)2-5-14(18)19/h2-5,7,9,11H,6,8H2,1H3,(H,17,20)(H,18,19)/b5-2+ |
| InChIKey | ACCVTINQKGOREA-GORDUTHDSA-N |
| XLogP | 2.29 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.29 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|