C14H15NO3 — CID 94230826
(E)-3-[4-(cyclopropanecarbonylamino)-2-methylphenyl]prop-2-enoic acid (PubChem CID 94230826) has the molecular formula C14H15NO3 and a molecular weight of 245.28 g/mol. Its IUPAC name is (E)-3-[4-(cyclopropanecarbonylamino)-2-methylphenyl]prop-2-enoic acid.
| Compound Name | (E)-3-[4-(cyclopropanecarbonylamino)-2-methylphenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 94230826 |
| Molecular Formula | C14H15NO3 |
| Molecular Weight | 245.28 g/mol |
| Exact Mass | 245.11 |
| IUPAC Name | (E)-3-[4-(cyclopropanecarbonylamino)-2-methylphenyl]prop-2-enoic acid |
| SMILES | Cc1cc(NC(=O)C2CC2)ccc1/C=C/C(=O)O |
| InChI | InChI=1S/C14H15NO3/c1-9-8-12(15-14(18)11-2-3-11)6-4-10(9)5-7-13(16)17/h4-8,11H,2-3H2,1H3,(H,15,18)(H,16,17)/b7-5+ |
| InChIKey | NHOSORKAZIEHBP-FNORWQNLSA-N |
| XLogP | 2.44 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.28 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|