C11H12N2O3 — CID 82236981
(E)-3-[4-(carbamoylamino)-2-methylphenyl]prop-2-enoic acid (PubChem CID 82236981) has the molecular formula C11H12N2O3 and a molecular weight of 220.23 g/mol. Its IUPAC name is (E)-3-[4-(carbamoylamino)-2-methylphenyl]prop-2-enoic acid.
| Compound Name | (E)-3-[4-(carbamoylamino)-2-methylphenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 82236981 |
| Molecular Formula | C11H12N2O3 |
| Molecular Weight | 220.23 g/mol |
| Exact Mass | 220.08 |
| IUPAC Name | (E)-3-[4-(carbamoylamino)-2-methylphenyl]prop-2-enoic acid |
| SMILES | Cc1cc(NC(N)=O)ccc1/C=C/C(=O)O |
| InChI | InChI=1S/C11H12N2O3/c1-7-6-9(13-11(12)16)4-2-8(7)3-5-10(14)15/h2-6H,1H3,(H,14,15)(H3,12,13,16)/b5-3+ |
| InChIKey | FCLXFTIGDTXLIX-HWKANZROSA-N |
| XLogP | 1.58 |
| TPSA | 92.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.23 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|