C13H14FNO3S — CID 104781384
(E)-3-[2-fluoro-5-(3-methylsulfanylpropanoylamino)phenyl]prop-2-enoic acid (PubChem CID 104781384) has the molecular formula C13H14FNO3S and a molecular weight of 283.32 g/mol. Its IUPAC name is (E)-3-[2-fluoro-5-(3-methylsulfanylpropanoylamino)phenyl]prop-2-enoic acid.
| Compound Name | (E)-3-[2-fluoro-5-(3-methylsulfanylpropanoylamino)phenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 104781384 |
| Molecular Formula | C13H14FNO3S |
| Molecular Weight | 283.32 g/mol |
| Exact Mass | 283.07 |
| IUPAC Name | (E)-3-[2-fluoro-5-(3-methylsulfanylpropanoylamino)phenyl]prop-2-enoic acid |
| SMILES | CSCCC(=O)Nc1ccc(F)c(/C=C/C(=O)O)c1 |
| InChI | InChI=1S/C13H14FNO3S/c1-19-7-6-12(16)15-10-3-4-11(14)9(8-10)2-5-13(17)18/h2-5,8H,6-7H2,1H3,(H,15,16)(H,17,18)/b5-2+ |
| InChIKey | WVKIKLSLKBCIQQ-GORDUTHDSA-N |
| XLogP | 2.62 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.32 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|