C14H14FNO3 — CID 77069539
3-[4-[(2-cyclopropylacetyl)amino]-2-fluorophenyl]prop-2-enoic acid (PubChem CID 77069539) has the molecular formula C14H14FNO3 and a molecular weight of 263.27 g/mol. Its IUPAC name is 3-[4-[(2-cyclopropylacetyl)amino]-2-fluorophenyl]prop-2-enoic acid.
| Compound Name | 3-[4-[(2-cyclopropylacetyl)amino]-2-fluorophenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 77069539 |
| Molecular Formula | C14H14FNO3 |
| Molecular Weight | 263.27 g/mol |
| Exact Mass | 263.10 |
| IUPAC Name | 3-[4-[(2-cyclopropylacetyl)amino]-2-fluorophenyl]prop-2-enoic acid |
| SMILES | O=C(O)C=Cc1ccc(NC(=O)CC2CC2)cc1F |
| InChI | InChI=1S/C14H14FNO3/c15-12-8-11(16-13(17)7-9-1-2-9)5-3-10(12)4-6-14(18)19/h3-6,8-9H,1-2,7H2,(H,16,17)(H,18,19) |
| InChIKey | UIPYCOHXHPBDRV-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.27 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|