C20H27F2NO — CID 121325202
2-(4-cyclohexylcyclohexyl)-N-(3,4-difluorophenyl)acetamide (PubChem CID 121325202) has the molecular formula C20H27F2NO and a molecular weight of 335.44 g/mol. Its IUPAC name is 2-(4-cyclohexylcyclohexyl)-N-(3,4-difluorophenyl)acetamide.
| Compound Name | 2-(4-cyclohexylcyclohexyl)-N-(3,4-difluorophenyl)acetamide |
|---|---|
| PubChem CID | 121325202 |
| Molecular Formula | C20H27F2NO |
| Molecular Weight | 335.44 g/mol |
| Exact Mass | 335.21 |
| IUPAC Name | 2-(4-cyclohexylcyclohexyl)-N-(3,4-difluorophenyl)acetamide |
| SMILES | O=C(CC1CCC(C2CCCCC2)CC1)Nc1ccc(F)c(F)c1 |
| InChI | InChI=1S/C20H27F2NO/c21-18-11-10-17(13-19(18)22)23-20(24)12-14-6-8-16(9-7-14)15-4-2-1-3-5-15/h10-11,13-16H,1-9,12H2,(H,23,24) |
| InChIKey | XJWRWZLTQOQGHO-UHFFFAOYSA-N |
| XLogP | 5.68 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.44 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |