C16H22F2N2O — CID 109031667
3-(cycloheptylamino)-N-(3,4-difluorophenyl)propanamide (PubChem CID 109031667) has the molecular formula C16H22F2N2O and a molecular weight of 296.36 g/mol. Its IUPAC name is 3-(cycloheptylamino)-N-(3,4-difluorophenyl)propanamide.
| Compound Name | 3-(cycloheptylamino)-N-(3,4-difluorophenyl)propanamide |
|---|---|
| PubChem CID | 109031667 |
| Molecular Formula | C16H22F2N2O |
| Molecular Weight | 296.36 g/mol |
| Exact Mass | 296.17 |
| IUPAC Name | 3-(cycloheptylamino)-N-(3,4-difluorophenyl)propanamide |
| SMILES | O=C(CCNC1CCCCCC1)Nc1ccc(F)c(F)c1 |
| InChI | InChI=1S/C16H22F2N2O/c17-14-8-7-13(11-15(14)18)20-16(21)9-10-19-12-5-3-1-2-4-6-12/h7-8,11-12,19H,1-6,9-10H2,(H,20,21) |
| InChIKey | HCOTXDWXXMUJMS-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.36 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |