C12H13F3N2O — CID 62813705
3-(cyclopropylamino)-N-(3,4,5-trifluorophenyl)propanamide (PubChem CID 62813705) has the molecular formula C12H13F3N2O and a molecular weight of 258.24 g/mol. Its IUPAC name is 3-(cyclopropylamino)-N-(3,4,5-trifluorophenyl)propanamide.
| Compound Name | 3-(cyclopropylamino)-N-(3,4,5-trifluorophenyl)propanamide |
|---|---|
| PubChem CID | 62813705 |
| Molecular Formula | C12H13F3N2O |
| Molecular Weight | 258.24 g/mol |
| Exact Mass | 258.10 |
| IUPAC Name | 3-(cyclopropylamino)-N-(3,4,5-trifluorophenyl)propanamide |
| SMILES | O=C(CCNC1CC1)Nc1cc(F)c(F)c(F)c1 |
| InChI | InChI=1S/C12H13F3N2O/c13-9-5-8(6-10(14)12(9)15)17-11(18)3-4-16-7-1-2-7/h5-7,16H,1-4H2,(H,17,18) |
| InChIKey | ZHEPWMJHHGGQMG-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.24 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|