C15H16FNO3 — CID 76909883
3-[3-[[(2-cyclopropylacetyl)amino]methyl]-4-fluorophenyl]prop-2-enoic acid (PubChem CID 76909883) has the molecular formula C15H16FNO3 and a molecular weight of 277.30 g/mol. Its IUPAC name is 3-[3-[[(2-cyclopropylacetyl)amino]methyl]-4-fluorophenyl]prop-2-enoic acid.
| Compound Name | 3-[3-[[(2-cyclopropylacetyl)amino]methyl]-4-fluorophenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 76909883 |
| Molecular Formula | C15H16FNO3 |
| Molecular Weight | 277.30 g/mol |
| Exact Mass | 277.11 |
| IUPAC Name | 3-[3-[[(2-cyclopropylacetyl)amino]methyl]-4-fluorophenyl]prop-2-enoic acid |
| SMILES | O=C(O)C=Cc1ccc(F)c(CNC(=O)CC2CC2)c1 |
| InChI | InChI=1S/C15H16FNO3/c16-13-5-3-10(4-6-15(19)20)7-12(13)9-17-14(18)8-11-1-2-11/h3-7,11H,1-2,8-9H2,(H,17,18)(H,19,20) |
| InChIKey | MUUNFVSDMOWNEQ-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.30 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|