C15H17NO3 — CID 103925644
(E)-3-[4-[(2-cyclobutylacetyl)amino]phenyl]prop-2-enoic acid (PubChem CID 103925644) has the molecular formula C15H17NO3 and a molecular weight of 259.31 g/mol. Its IUPAC name is (E)-3-[4-[(2-cyclobutylacetyl)amino]phenyl]prop-2-enoic acid.
| Compound Name | (E)-3-[4-[(2-cyclobutylacetyl)amino]phenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 103925644 |
| Molecular Formula | C15H17NO3 |
| Molecular Weight | 259.31 g/mol |
| Exact Mass | 259.12 |
| IUPAC Name | (E)-3-[4-[(2-cyclobutylacetyl)amino]phenyl]prop-2-enoic acid |
| SMILES | O=C(O)/C=C/c1ccc(NC(=O)CC2CCC2)cc1 |
| InChI | InChI=1S/C15H17NO3/c17-14(10-12-2-1-3-12)16-13-7-4-11(5-8-13)6-9-15(18)19/h4-9,12H,1-3,10H2,(H,16,17)(H,18,19)/b9-6+ |
| InChIKey | JKXNEZZGXKAQHV-RMKNXTFCSA-N |
| XLogP | 2.91 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.31 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|