C14H14FNO5 — CID 104781366
(E)-3-[5-(1,4-dioxane-2-carbonylamino)-2-fluorophenyl]prop-2-enoic acid (PubChem CID 104781366) has the molecular formula C14H14FNO5 and a molecular weight of 295.27 g/mol. Its IUPAC name is (E)-3-[5-(1,4-dioxane-2-carbonylamino)-2-fluorophenyl]prop-2-enoic acid.
| Compound Name | (E)-3-[5-(1,4-dioxane-2-carbonylamino)-2-fluorophenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 104781366 |
| Molecular Formula | C14H14FNO5 |
| Molecular Weight | 295.27 g/mol |
| Exact Mass | 295.09 |
| IUPAC Name | (E)-3-[5-(1,4-dioxane-2-carbonylamino)-2-fluorophenyl]prop-2-enoic acid |
| SMILES | O=C(O)/C=C/c1cc(NC(=O)C2COCCO2)ccc1F |
| InChI | InChI=1S/C14H14FNO5/c15-11-3-2-10(7-9(11)1-4-13(17)18)16-14(19)12-8-20-5-6-21-12/h1-4,7,12H,5-6,8H2,(H,16,19)(H,17,18)/b4-1+ |
| InChIKey | XYOFACDHZNCVIF-DAFODLJHSA-N |
| XLogP | 1.28 |
| TPSA | 84.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.27 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|