C11H12ClNO4 — CID 64788498
N-(3-chloro-4-hydroxyphenyl)-1,4-dioxane-2-carboxamide (PubChem CID 64788498) has the molecular formula C11H12ClNO4 and a molecular weight of 257.67 g/mol. Its IUPAC name is N-(3-chloro-4-hydroxyphenyl)-1,4-dioxane-2-carboxamide.
| Compound Name | N-(3-chloro-4-hydroxyphenyl)-1,4-dioxane-2-carboxamide |
|---|---|
| PubChem CID | 64788498 |
| Molecular Formula | C11H12ClNO4 |
| Molecular Weight | 257.67 g/mol |
| Exact Mass | 257.05 |
| IUPAC Name | N-(3-chloro-4-hydroxyphenyl)-1,4-dioxane-2-carboxamide |
| SMILES | O=C(Nc1ccc(O)c(Cl)c1)C1COCCO1 |
| InChI | InChI=1S/C11H12ClNO4/c12-8-5-7(1-2-9(8)14)13-11(15)10-6-16-3-4-17-10/h1-2,5,10,14H,3-4,6H2,(H,13,15) |
| InChIKey | QFSSQEBAVTTYKS-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 67.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.67 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|