C11H13NO3 — CID 39885866
(2S)-N-phenyl-1,4-dioxane-2-carboxamide (PubChem CID 39885866) has the molecular formula C11H13NO3 and a molecular weight of 207.23 g/mol. Its IUPAC name is (2S)-N-phenyl-1,4-dioxane-2-carboxamide.
| Compound Name | (2S)-N-phenyl-1,4-dioxane-2-carboxamide |
|---|---|
| PubChem CID | 39885866 |
| Molecular Formula | C11H13NO3 |
| Molecular Weight | 207.23 g/mol |
| Exact Mass | 207.09 |
| IUPAC Name | (2S)-N-phenyl-1,4-dioxane-2-carboxamide |
| SMILES | O=C(Nc1ccccc1)[C@@H]1COCCO1 |
| InChI | InChI=1S/C11H13NO3/c13-11(10-8-14-6-7-15-10)12-9-4-2-1-3-5-9/h1-5,10H,6-8H2,(H,12,13)/t10-/m0/s1 |
| InChIKey | AMBSRHNVKIEEFT-JTQLQIEISA-N |
| XLogP | 1.04 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.23 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |