C15H17NO4 — CID 62805457
N-[4-(4-hydroxybut-1-ynyl)phenyl]-1,4-dioxane-2-carboxamide (PubChem CID 62805457) has the molecular formula C15H17NO4 and a molecular weight of 275.30 g/mol. Its IUPAC name is N-[4-(4-hydroxybut-1-ynyl)phenyl]-1,4-dioxane-2-carboxamide.
| Compound Name | N-[4-(4-hydroxybut-1-ynyl)phenyl]-1,4-dioxane-2-carboxamide |
|---|---|
| PubChem CID | 62805457 |
| Molecular Formula | C15H17NO4 |
| Molecular Weight | 275.30 g/mol |
| Exact Mass | 275.12 |
| IUPAC Name | N-[4-(4-hydroxybut-1-ynyl)phenyl]-1,4-dioxane-2-carboxamide |
| SMILES | O=C(Nc1ccc(C#CCCO)cc1)C1COCCO1 |
| InChI | InChI=1S/C15H17NO4/c17-8-2-1-3-12-4-6-13(7-5-12)16-15(18)14-11-19-9-10-20-14/h4-7,14,17H,2,8-11H2,(H,16,18) |
| InChIKey | XVSPLHGBDZEHLY-UHFFFAOYSA-N |
| XLogP | 0.77 |
| TPSA | 67.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.30 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|