C13H13NO3 — CID 47176741
N-(3-ethynylphenyl)-1,4-dioxane-2-carboxamide (PubChem CID 47176741) has the molecular formula C13H13NO3 and a molecular weight of 231.25 g/mol. Its IUPAC name is N-(3-ethynylphenyl)-1,4-dioxane-2-carboxamide.
| Compound Name | N-(3-ethynylphenyl)-1,4-dioxane-2-carboxamide |
|---|---|
| PubChem CID | 47176741 |
| Molecular Formula | C13H13NO3 |
| Molecular Weight | 231.25 g/mol |
| Exact Mass | 231.09 |
| IUPAC Name | N-(3-ethynylphenyl)-1,4-dioxane-2-carboxamide |
| SMILES | C#Cc1cccc(NC(=O)C2COCCO2)c1 |
| InChI | InChI=1S/C13H13NO3/c1-2-10-4-3-5-11(8-10)14-13(15)12-9-16-6-7-17-12/h1,3-5,8,12H,6-7,9H2,(H,14,15) |
| InChIKey | YZVOXDDXQBUOPC-UHFFFAOYSA-N |
| XLogP | 1.02 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.25 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|