C16H19NO4 — CID 82747691
N-[2-(4-hydroxybut-1-ynyl)-5-methylphenyl]-1,4-dioxane-2-carboxamide (PubChem CID 82747691) has the molecular formula C16H19NO4 and a molecular weight of 289.33 g/mol. Its IUPAC name is N-[2-(4-hydroxybut-1-ynyl)-5-methylphenyl]-1,4-dioxane-2-carboxamide.
| Compound Name | N-[2-(4-hydroxybut-1-ynyl)-5-methylphenyl]-1,4-dioxane-2-carboxamide |
|---|---|
| PubChem CID | 82747691 |
| Molecular Formula | C16H19NO4 |
| Molecular Weight | 289.33 g/mol |
| Exact Mass | 289.13 |
| IUPAC Name | N-[2-(4-hydroxybut-1-ynyl)-5-methylphenyl]-1,4-dioxane-2-carboxamide |
| SMILES | Cc1ccc(C#CCCO)c(NC(=O)C2COCCO2)c1 |
| InChI | InChI=1S/C16H19NO4/c1-12-5-6-13(4-2-3-7-18)14(10-12)17-16(19)15-11-20-8-9-21-15/h5-6,10,15,18H,3,7-9,11H2,1H3,(H,17,19) |
| InChIKey | STFWCPXSQRVIIU-UHFFFAOYSA-N |
| XLogP | 1.08 |
| TPSA | 67.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.33 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|