C14H15ClN2O3 — CID 81270841
N-[2-(3-aminoprop-1-ynyl)-4-chlorophenyl]-1,4-dioxane-2-carboxamide (PubChem CID 81270841) has the molecular formula C14H15ClN2O3 and a molecular weight of 294.74 g/mol. Its IUPAC name is N-[2-(3-aminoprop-1-ynyl)-4-chlorophenyl]-1,4-dioxane-2-carboxamide.
| Compound Name | N-[2-(3-aminoprop-1-ynyl)-4-chlorophenyl]-1,4-dioxane-2-carboxamide |
|---|---|
| PubChem CID | 81270841 |
| Molecular Formula | C14H15ClN2O3 |
| Molecular Weight | 294.74 g/mol |
| Exact Mass | 294.08 |
| IUPAC Name | N-[2-(3-aminoprop-1-ynyl)-4-chlorophenyl]-1,4-dioxane-2-carboxamide |
| SMILES | NCC#Cc1cc(Cl)ccc1NC(=O)C1COCCO1 |
| InChI | InChI=1S/C14H15ClN2O3/c15-11-3-4-12(10(8-11)2-1-5-16)17-14(18)13-9-19-6-7-20-13/h3-4,8,13H,5-7,9,16H2,(H,17,18) |
| InChIKey | CQIJCSDRKLWMFY-UHFFFAOYSA-N |
| XLogP | 1.00 |
| TPSA | 73.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.74 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|