C12H11FN2O3 — CID 79954692
N-(2-cyano-4-fluorophenyl)-1,4-dioxane-2-carboxamide (PubChem CID 79954692) has the molecular formula C12H11FN2O3 and a molecular weight of 250.23 g/mol. Its IUPAC name is N-(2-cyano-4-fluorophenyl)-1,4-dioxane-2-carboxamide.
| Compound Name | N-(2-cyano-4-fluorophenyl)-1,4-dioxane-2-carboxamide |
|---|---|
| PubChem CID | 79954692 |
| Molecular Formula | C12H11FN2O3 |
| Molecular Weight | 250.23 g/mol |
| Exact Mass | 250.08 |
| IUPAC Name | N-(2-cyano-4-fluorophenyl)-1,4-dioxane-2-carboxamide |
| SMILES | N#Cc1cc(F)ccc1NC(=O)C1COCCO1 |
| InChI | InChI=1S/C12H11FN2O3/c13-9-1-2-10(8(5-9)6-14)15-12(16)11-7-17-3-4-18-11/h1-2,5,11H,3-4,7H2,(H,15,16) |
| InChIKey | NWDBWNDCODYHKS-UHFFFAOYSA-N |
| XLogP | 1.05 |
| TPSA | 71.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.23 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |