C12H12FNO5 — CID 43359644
2-(1,4-dioxane-2-carbonylamino)-5-fluorobenzoic acid (PubChem CID 43359644) has the molecular formula C12H12FNO5 and a molecular weight of 269.23 g/mol. Its IUPAC name is 2-(1,4-dioxane-2-carbonylamino)-5-fluorobenzoic acid.
| Compound Name | 2-(1,4-dioxane-2-carbonylamino)-5-fluorobenzoic acid |
|---|---|
| PubChem CID | 43359644 |
| Molecular Formula | C12H12FNO5 |
| Molecular Weight | 269.23 g/mol |
| Exact Mass | 269.07 |
| IUPAC Name | 2-(1,4-dioxane-2-carbonylamino)-5-fluorobenzoic acid |
| SMILES | O=C(O)c1cc(F)ccc1NC(=O)C1COCCO1 |
| InChI | InChI=1S/C12H12FNO5/c13-7-1-2-9(8(5-7)12(16)17)14-11(15)10-6-18-3-4-19-10/h1-2,5,10H,3-4,6H2,(H,14,15)(H,16,17) |
| InChIKey | JXUGIELIWMSWRN-UHFFFAOYSA-N |
| XLogP | 0.88 |
| TPSA | 84.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.23 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |