C11H13FN2O5S — CID 62803145
N-(2-fluoro-5-sulfamoylphenyl)-1,4-dioxane-2-carboxamide (PubChem CID 62803145) has the molecular formula C11H13FN2O5S and a molecular weight of 304.30 g/mol. Its IUPAC name is N-(2-fluoro-5-sulfamoylphenyl)-1,4-dioxane-2-carboxamide.
| Compound Name | N-(2-fluoro-5-sulfamoylphenyl)-1,4-dioxane-2-carboxamide |
|---|---|
| PubChem CID | 62803145 |
| Molecular Formula | C11H13FN2O5S |
| Molecular Weight | 304.30 g/mol |
| Exact Mass | 304.05 |
| IUPAC Name | N-(2-fluoro-5-sulfamoylphenyl)-1,4-dioxane-2-carboxamide |
| SMILES | NS(=O)(=O)c1ccc(F)c(NC(=O)C2COCCO2)c1 |
| InChI | InChI=1S/C11H13FN2O5S/c12-8-2-1-7(20(13,16)17)5-9(8)14-11(15)10-6-18-3-4-19-10/h1-2,5,10H,3-4,6H2,(H,14,15)(H2,13,16,17) |
| InChIKey | OWKMVFWALMKJTA-UHFFFAOYSA-N |
| XLogP | -0.17 |
| TPSA | 107.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.30 |
| LogP ≤ 5 | -0.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |