C14H8F3N3O — CID 115279853
1-(2-cyano-4-fluorophenyl)-3-(2,4-difluorophenyl)urea (PubChem CID 115279853) has the molecular formula C14H8F3N3O and a molecular weight of 291.23 g/mol. Its IUPAC name is 1-(2-cyano-4-fluorophenyl)-3-(2,4-difluorophenyl)urea.
| Compound Name | 1-(2-cyano-4-fluorophenyl)-3-(2,4-difluorophenyl)urea |
|---|---|
| PubChem CID | 115279853 |
| Molecular Formula | C14H8F3N3O |
| Molecular Weight | 291.23 g/mol |
| Exact Mass | 291.06 |
| IUPAC Name | 1-(2-cyano-4-fluorophenyl)-3-(2,4-difluorophenyl)urea |
| SMILES | N#Cc1cc(F)ccc1NC(=O)Nc1ccc(F)cc1F |
| InChI | InChI=1S/C14H8F3N3O/c15-9-1-3-12(8(5-9)7-18)19-14(21)20-13-4-2-10(16)6-11(13)17/h1-6H,(H2,19,20,21) |
| InChIKey | RNBGBUTZFBPBDY-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 64.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.23 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |