C11H9F4N3O — CID 78894621
1-(2-cyano-4-fluorophenyl)-3-(3,3,3-trifluoropropyl)urea (PubChem CID 78894621) has the molecular formula C11H9F4N3O and a molecular weight of 275.20 g/mol. Its IUPAC name is 1-(2-cyano-4-fluorophenyl)-3-(3,3,3-trifluoropropyl)urea.
| Compound Name | 1-(2-cyano-4-fluorophenyl)-3-(3,3,3-trifluoropropyl)urea |
|---|---|
| PubChem CID | 78894621 |
| Molecular Formula | C11H9F4N3O |
| Molecular Weight | 275.20 g/mol |
| Exact Mass | 275.07 |
| IUPAC Name | 1-(2-cyano-4-fluorophenyl)-3-(3,3,3-trifluoropropyl)urea |
| SMILES | N#Cc1cc(F)ccc1NC(=O)NCCC(F)(F)F |
| InChI | InChI=1S/C11H9F4N3O/c12-8-1-2-9(7(5-8)6-16)18-10(19)17-4-3-11(13,14)15/h1-2,5H,3-4H2,(H2,17,18,19) |
| InChIKey | VJDKAYIARLDIJS-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 64.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.20 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |