C10H7F4N3O — CID 115577068
1-(2-cyano-4-fluorophenyl)-3-(2,2,2-trifluoroethyl)urea (PubChem CID 115577068) has the molecular formula C10H7F4N3O and a molecular weight of 261.18 g/mol. Its IUPAC name is 1-(2-cyano-4-fluorophenyl)-3-(2,2,2-trifluoroethyl)urea.
| Compound Name | 1-(2-cyano-4-fluorophenyl)-3-(2,2,2-trifluoroethyl)urea |
|---|---|
| PubChem CID | 115577068 |
| Molecular Formula | C10H7F4N3O |
| Molecular Weight | 261.18 g/mol |
| Exact Mass | 261.05 |
| IUPAC Name | 1-(2-cyano-4-fluorophenyl)-3-(2,2,2-trifluoroethyl)urea |
| SMILES | N#Cc1cc(F)ccc1NC(=O)NCC(F)(F)F |
| InChI | InChI=1S/C10H7F4N3O/c11-7-1-2-8(6(3-7)4-15)17-9(18)16-5-10(12,13)14/h1-3H,5H2,(H2,16,17,18) |
| InChIKey | WRTVSIYMDPWRER-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 64.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.18 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |