C16H14F4N2O5S — CID 20610356
(2R)-3,3,3-trifluoro-N-[2-fluoro-4-[(4-hydroxyphenyl)sulfamoyl]phenyl]-2-hydroxy-2-methylpropanamide (PubChem CID 20610356) has the molecular formula C16H14F4N2O5S and a molecular weight of 422.36 g/mol. Its IUPAC name is (2R)-3,3,3-trifluoro-N-[2-fluoro-4-[(4-hydroxyphenyl)sulfamoyl]phenyl]-2-hydroxy-2-methylpropanamide.
| Compound Name | (2R)-3,3,3-trifluoro-N-[2-fluoro-4-[(4-hydroxyphenyl)sulfamoyl]phenyl]-2-hydroxy-2-methylpropanamide |
|---|---|
| PubChem CID | 20610356 |
| Molecular Formula | C16H14F4N2O5S |
| Molecular Weight | 422.36 g/mol |
| Exact Mass | 422.06 |
| IUPAC Name | (2R)-3,3,3-trifluoro-N-[2-fluoro-4-[(4-hydroxyphenyl)sulfamoyl]phenyl]-2-hydroxy-2-methylpropanamide |
| SMILES | C[C@@](O)(C(=O)Nc1ccc(S(=O)(=O)Nc2ccc(O)cc2)cc1F)C(F)(F)F |
| InChI | InChI=1S/C16H14F4N2O5S/c1-15(25,16(18,19)20)14(24)21-13-7-6-11(8-12(13)17)28(26,27)22-9-2-4-10(23)5-3-9/h2-8,22-23,25H,1H3,(H,21,24)/t15-/m1/s1 |
| InChIKey | CZLZSSHDSKAAJS-OAHLLOKOSA-N |
| XLogP | 2.58 |
| TPSA | 115.73 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.36 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'sulfonamide_B(41)', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|