C14H14N2O4S2 — CID 166176655
N-[4-[(4-hydroxyphenyl)sulfamoyl]-2-sulfanylphenyl]acetamide (PubChem CID 166176655) has the molecular formula C14H14N2O4S2 and a molecular weight of 338.41 g/mol. Its IUPAC name is N-[4-[(4-hydroxyphenyl)sulfamoyl]-2-sulfanylphenyl]acetamide.
| Compound Name | N-[4-[(4-hydroxyphenyl)sulfamoyl]-2-sulfanylphenyl]acetamide |
|---|---|
| PubChem CID | 166176655 |
| Molecular Formula | C14H14N2O4S2 |
| Molecular Weight | 338.41 g/mol |
| Exact Mass | 338.04 |
| IUPAC Name | N-[4-[(4-hydroxyphenyl)sulfamoyl]-2-sulfanylphenyl]acetamide |
| SMILES | CC(=O)Nc1ccc(S(=O)(=O)Nc2ccc(O)cc2)cc1S |
| InChI | InChI=1S/C14H14N2O4S2/c1-9(17)15-13-7-6-12(8-14(13)21)22(19,20)16-10-2-4-11(18)5-3-10/h2-8,16,18,21H,1H3,(H,15,17) |
| InChIKey | RWOFMYJLUAKQLB-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 95.50 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.41 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'sulfonamide_B(41)', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|