C15H17N3O6S2 — CID 26951375
N-[2-methoxy-5-[(4-sulfamoylphenyl)sulfamoyl]phenyl]acetamide (PubChem CID 26951375) has the molecular formula C15H17N3O6S2 and a molecular weight of 399.45 g/mol. Its IUPAC name is N-[2-methoxy-5-[(4-sulfamoylphenyl)sulfamoyl]phenyl]acetamide.
| Compound Name | N-[2-methoxy-5-[(4-sulfamoylphenyl)sulfamoyl]phenyl]acetamide |
|---|---|
| PubChem CID | 26951375 |
| Molecular Formula | C15H17N3O6S2 |
| Molecular Weight | 399.45 g/mol |
| Exact Mass | 399.06 |
| IUPAC Name | N-[2-methoxy-5-[(4-sulfamoylphenyl)sulfamoyl]phenyl]acetamide |
| SMILES | COc1ccc(S(=O)(=O)Nc2ccc(S(N)(=O)=O)cc2)cc1NC(C)=O |
| InChI | InChI=1S/C15H17N3O6S2/c1-10(19)17-14-9-13(7-8-15(14)24-2)26(22,23)18-11-3-5-12(6-4-11)25(16,20)21/h3-9,18H,1-2H3,(H,17,19)(H2,16,20,21) |
| InChIKey | IGUVIVQJEPJWDC-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 144.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.45 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |