C17H21N3O7S2 — CID 25331599
N-[5-[[5-(dimethylsulfamoyl)-2-hydroxyphenyl]sulfamoyl]-2-methoxyphenyl]acetamide (PubChem CID 25331599) has the molecular formula C17H21N3O7S2 and a molecular weight of 443.50 g/mol. Its IUPAC name is N-[5-[[5-(dimethylsulfamoyl)-2-hydroxyphenyl]sulfamoyl]-2-methoxyphenyl]acetamide.
| Compound Name | N-[5-[[5-(dimethylsulfamoyl)-2-hydroxyphenyl]sulfamoyl]-2-methoxyphenyl]acetamide |
|---|---|
| PubChem CID | 25331599 |
| Molecular Formula | C17H21N3O7S2 |
| Molecular Weight | 443.50 g/mol |
| Exact Mass | 443.08 |
| IUPAC Name | N-[5-[[5-(dimethylsulfamoyl)-2-hydroxyphenyl]sulfamoyl]-2-methoxyphenyl]acetamide |
| SMILES | COc1ccc(S(=O)(=O)Nc2cc(S(=O)(=O)N(C)C)ccc2O)cc1NC(C)=O |
| InChI | InChI=1S/C17H21N3O7S2/c1-11(21)18-15-9-12(6-8-17(15)27-4)28(23,24)19-14-10-13(5-7-16(14)22)29(25,26)20(2)3/h5-10,19,22H,1-4H3,(H,18,21) |
| InChIKey | AVEPCIBPXWOWGN-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 142.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.50 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|