C20H20F3N3O4 — CID 108917393
tert-butyl N-[2-oxo-2-[2-[(2,3,4-trifluorobenzoyl)amino]anilino]ethyl]carbamate (PubChem CID 108917393) has the molecular formula C20H20F3N3O4 and a molecular weight of 423.39 g/mol. Its IUPAC name is tert-butyl N-[2-oxo-2-[2-[(2,3,4-trifluorobenzoyl)amino]anilino]ethyl]carbamate.
| Compound Name | tert-butyl N-[2-oxo-2-[2-[(2,3,4-trifluorobenzoyl)amino]anilino]ethyl]carbamate |
|---|---|
| PubChem CID | 108917393 |
| Molecular Formula | C20H20F3N3O4 |
| Molecular Weight | 423.39 g/mol |
| Exact Mass | 423.14 |
| IUPAC Name | tert-butyl N-[2-oxo-2-[2-[(2,3,4-trifluorobenzoyl)amino]anilino]ethyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCC(=O)Nc1ccccc1NC(=O)c1ccc(F)c(F)c1F |
| InChI | InChI=1S/C20H20F3N3O4/c1-20(2,3)30-19(29)24-10-15(27)25-13-6-4-5-7-14(13)26-18(28)11-8-9-12(21)17(23)16(11)22/h4-9H,10H2,1-3H3,(H,24,29)(H,25,27)(H,26,28) |
| InChIKey | RNERRHHBIGWTPN-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 96.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.39 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|