C21H20F2N4O2S — CID 56500100
N-(3-fluoro-4-morpholin-4-ylphenyl)-3-(4-fluorophenyl)-2-methylsulfanylimidazole-4-carboxamide (PubChem CID 56500100) has the molecular formula C21H20F2N4O2S and a molecular weight of 430.48 g/mol. Its IUPAC name is N-(3-fluoro-4-morpholin-4-ylphenyl)-3-(4-fluorophenyl)-2-methylsulfanylimidazole-4-carboxamide.
| Compound Name | N-(3-fluoro-4-morpholin-4-ylphenyl)-3-(4-fluorophenyl)-2-methylsulfanylimidazole-4-carboxamide |
|---|---|
| PubChem CID | 56500100 |
| Molecular Formula | C21H20F2N4O2S |
| Molecular Weight | 430.48 g/mol |
| Exact Mass | 430.13 |
| IUPAC Name | N-(3-fluoro-4-morpholin-4-ylphenyl)-3-(4-fluorophenyl)-2-methylsulfanylimidazole-4-carboxamide |
| SMILES | CSc1ncc(C(=O)Nc2ccc(N3CCOCC3)c(F)c2)n1-c1ccc(F)cc1 |
| InChI | InChI=1S/C21H20F2N4O2S/c1-30-21-24-13-19(27(21)16-5-2-14(22)3-6-16)20(28)25-15-4-7-18(17(23)12-15)26-8-10-29-11-9-26/h2-7,12-13H,8-11H2,1H3,(H,25,28) |
| InChIKey | OMMQIRNNLMDKQA-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 59.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.48 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|