C17H12BrF2N3OS — CID 16552781
N-(4-bromo-2-fluorophenyl)-3-(4-fluorophenyl)-2-methylsulfanylimidazole-4-carboxamide (PubChem CID 16552781) has the molecular formula C17H12BrF2N3OS and a molecular weight of 424.27 g/mol. Its IUPAC name is N-(4-bromo-2-fluorophenyl)-3-(4-fluorophenyl)-2-methylsulfanylimidazole-4-carboxamide.
| Compound Name | N-(4-bromo-2-fluorophenyl)-3-(4-fluorophenyl)-2-methylsulfanylimidazole-4-carboxamide |
|---|---|
| PubChem CID | 16552781 |
| Molecular Formula | C17H12BrF2N3OS |
| Molecular Weight | 424.27 g/mol |
| Exact Mass | 422.99 |
| IUPAC Name | N-(4-bromo-2-fluorophenyl)-3-(4-fluorophenyl)-2-methylsulfanylimidazole-4-carboxamide |
| SMILES | CSc1ncc(C(=O)Nc2ccc(Br)cc2F)n1-c1ccc(F)cc1 |
| InChI | InChI=1S/C17H12BrF2N3OS/c1-25-17-21-9-15(23(17)12-5-3-11(19)4-6-12)16(24)22-14-7-2-10(18)8-13(14)20/h2-9H,1H3,(H,22,24) |
| InChIKey | RUKYXCDUCDPKKL-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.27 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |