C20H18F2N4O2S — CID 55973799
N-[2-[(2-fluorobenzoyl)amino]ethyl]-3-(4-fluorophenyl)-2-methylsulfanylimidazole-4-carboxamide (PubChem CID 55973799) has the molecular formula C20H18F2N4O2S and a molecular weight of 416.45 g/mol. Its IUPAC name is N-[2-[(2-fluorobenzoyl)amino]ethyl]-3-(4-fluorophenyl)-2-methylsulfanylimidazole-4-carboxamide.
| Compound Name | N-[2-[(2-fluorobenzoyl)amino]ethyl]-3-(4-fluorophenyl)-2-methylsulfanylimidazole-4-carboxamide |
|---|---|
| PubChem CID | 55973799 |
| Molecular Formula | C20H18F2N4O2S |
| Molecular Weight | 416.45 g/mol |
| Exact Mass | 416.11 |
| IUPAC Name | N-[2-[(2-fluorobenzoyl)amino]ethyl]-3-(4-fluorophenyl)-2-methylsulfanylimidazole-4-carboxamide |
| SMILES | CSc1ncc(C(=O)NCCNC(=O)c2ccccc2F)n1-c1ccc(F)cc1 |
| InChI | InChI=1S/C20H18F2N4O2S/c1-29-20-25-12-17(26(20)14-8-6-13(21)7-9-14)19(28)24-11-10-23-18(27)15-4-2-3-5-16(15)22/h2-9,12H,10-11H2,1H3,(H,23,27)(H,24,28) |
| InChIKey | ANLKATWHYVAPOO-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 76.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.45 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|