C17H23FN4O3S2 — CID 55693544
N-[3-[ethylsulfonyl(methyl)amino]propyl]-3-(4-fluorophenyl)-2-methylsulfanylimidazole-4-carboxamide (PubChem CID 55693544) has the molecular formula C17H23FN4O3S2 and a molecular weight of 414.53 g/mol. Its IUPAC name is N-[3-[ethylsulfonyl(methyl)amino]propyl]-3-(4-fluorophenyl)-2-methylsulfanylimidazole-4-carboxamide.
| Compound Name | N-[3-[ethylsulfonyl(methyl)amino]propyl]-3-(4-fluorophenyl)-2-methylsulfanylimidazole-4-carboxamide |
|---|---|
| PubChem CID | 55693544 |
| Molecular Formula | C17H23FN4O3S2 |
| Molecular Weight | 414.53 g/mol |
| Exact Mass | 414.12 |
| IUPAC Name | N-[3-[ethylsulfonyl(methyl)amino]propyl]-3-(4-fluorophenyl)-2-methylsulfanylimidazole-4-carboxamide |
| SMILES | CCS(=O)(=O)N(C)CCCNC(=O)c1cnc(SC)n1-c1ccc(F)cc1 |
| InChI | InChI=1S/C17H23FN4O3S2/c1-4-27(24,25)21(2)11-5-10-19-16(23)15-12-20-17(26-3)22(15)14-8-6-13(18)7-9-14/h6-9,12H,4-5,10-11H2,1-3H3,(H,19,23) |
| InChIKey | YJIZKWXRZKNVJW-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 84.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.53 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|