C18H15FN4O2S — CID 30532232
N'-benzoyl-3-(4-fluorophenyl)-2-methylsulfanylimidazole-4-carbohydrazide (PubChem CID 30532232) has the molecular formula C18H15FN4O2S and a molecular weight of 370.41 g/mol. Its IUPAC name is N'-benzoyl-3-(4-fluorophenyl)-2-methylsulfanylimidazole-4-carbohydrazide.
| Compound Name | N'-benzoyl-3-(4-fluorophenyl)-2-methylsulfanylimidazole-4-carbohydrazide |
|---|---|
| PubChem CID | 30532232 |
| Molecular Formula | C18H15FN4O2S |
| Molecular Weight | 370.41 g/mol |
| Exact Mass | 370.09 |
| IUPAC Name | N'-benzoyl-3-(4-fluorophenyl)-2-methylsulfanylimidazole-4-carbohydrazide |
| SMILES | CSc1ncc(C(=O)NNC(=O)c2ccccc2)n1-c1ccc(F)cc1 |
| InChI | InChI=1S/C18H15FN4O2S/c1-26-18-20-11-15(23(18)14-9-7-13(19)8-10-14)17(25)22-21-16(24)12-5-3-2-4-6-12/h2-11H,1H3,(H,21,24)(H,22,25) |
| InChIKey | GSGABQNMMMEHND-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 76.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.41 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|