C20H17N5O2S — CID 30456352
N'-(2-methylsulfanyl-3-phenylimidazole-4-carbonyl)-1H-indole-3-carbohydrazide (PubChem CID 30456352) has the molecular formula C20H17N5O2S and a molecular weight of 391.46 g/mol. Its IUPAC name is N'-(2-methylsulfanyl-3-phenylimidazole-4-carbonyl)-1H-indole-3-carbohydrazide.
| Compound Name | N'-(2-methylsulfanyl-3-phenylimidazole-4-carbonyl)-1H-indole-3-carbohydrazide |
|---|---|
| PubChem CID | 30456352 |
| Molecular Formula | C20H17N5O2S |
| Molecular Weight | 391.46 g/mol |
| Exact Mass | 391.11 |
| IUPAC Name | N'-(2-methylsulfanyl-3-phenylimidazole-4-carbonyl)-1H-indole-3-carbohydrazide |
| SMILES | CSc1ncc(C(=O)NNC(=O)c2c[nH]c3ccccc23)n1-c1ccccc1 |
| InChI | InChI=1S/C20H17N5O2S/c1-28-20-22-12-17(25(20)13-7-3-2-4-8-13)19(27)24-23-18(26)15-11-21-16-10-6-5-9-14(15)16/h2-12,21H,1H3,(H,23,26)(H,24,27) |
| InChIKey | XCGNGTAIBCXXJQ-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 91.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.46 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|