C22H21N5O2 — CID 134034968
N'-[5-ethyl-1-(4-methylphenyl)pyrazole-4-carbonyl]-1H-indole-3-carbohydrazide (PubChem CID 134034968) has the molecular formula C22H21N5O2 and a molecular weight of 387.44 g/mol. Its IUPAC name is N'-[5-ethyl-1-(4-methylphenyl)pyrazole-4-carbonyl]-1H-indole-3-carbohydrazide.
| Compound Name | N'-[5-ethyl-1-(4-methylphenyl)pyrazole-4-carbonyl]-1H-indole-3-carbohydrazide |
|---|---|
| PubChem CID | 134034968 |
| Molecular Formula | C22H21N5O2 |
| Molecular Weight | 387.44 g/mol |
| Exact Mass | 387.17 |
| IUPAC Name | N'-[5-ethyl-1-(4-methylphenyl)pyrazole-4-carbonyl]-1H-indole-3-carbohydrazide |
| SMILES | CCc1c(C(=O)NNC(=O)c2c[nH]c3ccccc23)cnn1-c1ccc(C)cc1 |
| InChI | InChI=1S/C22H21N5O2/c1-3-20-18(13-24-27(20)15-10-8-14(2)9-11-15)22(29)26-25-21(28)17-12-23-19-7-5-4-6-16(17)19/h4-13,23H,3H2,1-2H3,(H,25,28)(H,26,29) |
| InChIKey | AFXLNDWBVSYIOC-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 91.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.44 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|