C19H17FN4O3 — CID 31978367
5-ethyl-1-(4-fluorophenyl)-N'-(2-hydroxybenzoyl)pyrazole-4-carbohydrazide (PubChem CID 31978367) has the molecular formula C19H17FN4O3 and a molecular weight of 368.37 g/mol. Its IUPAC name is 5-ethyl-1-(4-fluorophenyl)-N'-(2-hydroxybenzoyl)pyrazole-4-carbohydrazide.
| Compound Name | 5-ethyl-1-(4-fluorophenyl)-N'-(2-hydroxybenzoyl)pyrazole-4-carbohydrazide |
|---|---|
| PubChem CID | 31978367 |
| Molecular Formula | C19H17FN4O3 |
| Molecular Weight | 368.37 g/mol |
| Exact Mass | 368.13 |
| IUPAC Name | 5-ethyl-1-(4-fluorophenyl)-N'-(2-hydroxybenzoyl)pyrazole-4-carbohydrazide |
| SMILES | CCc1c(C(=O)NNC(=O)c2ccccc2O)cnn1-c1ccc(F)cc1 |
| InChI | InChI=1S/C19H17FN4O3/c1-2-16-15(11-21-24(16)13-9-7-12(20)8-10-13)19(27)23-22-18(26)14-5-3-4-6-17(14)25/h3-11,25H,2H2,1H3,(H,22,26)(H,23,27) |
| InChIKey | LPTIABGDEXCENN-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 96.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.37 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|