C16H18FN3O3 — CID 87040238
methyl (2S)-2-[[5-ethyl-1-(4-fluorophenyl)pyrazole-4-carbonyl]amino]propanoate (PubChem CID 87040238) has the molecular formula C16H18FN3O3 and a molecular weight of 319.34 g/mol. Its IUPAC name is methyl (2S)-2-[[5-ethyl-1-(4-fluorophenyl)pyrazole-4-carbonyl]amino]propanoate.
| Compound Name | methyl (2S)-2-[[5-ethyl-1-(4-fluorophenyl)pyrazole-4-carbonyl]amino]propanoate |
|---|---|
| PubChem CID | 87040238 |
| Molecular Formula | C16H18FN3O3 |
| Molecular Weight | 319.34 g/mol |
| Exact Mass | 319.13 |
| IUPAC Name | methyl (2S)-2-[[5-ethyl-1-(4-fluorophenyl)pyrazole-4-carbonyl]amino]propanoate |
| SMILES | CCc1c(C(=O)N[C@@H](C)C(=O)OC)cnn1-c1ccc(F)cc1 |
| InChI | InChI=1S/C16H18FN3O3/c1-4-14-13(15(21)19-10(2)16(22)23-3)9-18-20(14)12-7-5-11(17)6-8-12/h5-10H,4H2,1-3H3,(H,19,21)/t10-/m0/s1 |
| InChIKey | YNPSKJLBARUROG-JTQLQIEISA-N |
| XLogP | 1.87 |
| TPSA | 73.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.34 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |