C15H16FN3O3 — CID 119176883
3-[[5-ethyl-1-(4-fluorophenyl)pyrazole-4-carbonyl]amino]propanoic acid (PubChem CID 119176883) has the molecular formula C15H16FN3O3 and a molecular weight of 305.31 g/mol. Its IUPAC name is 3-[[5-ethyl-1-(4-fluorophenyl)pyrazole-4-carbonyl]amino]propanoic acid.
| Compound Name | 3-[[5-ethyl-1-(4-fluorophenyl)pyrazole-4-carbonyl]amino]propanoic acid |
|---|---|
| PubChem CID | 119176883 |
| Molecular Formula | C15H16FN3O3 |
| Molecular Weight | 305.31 g/mol |
| Exact Mass | 305.12 |
| IUPAC Name | 3-[[5-ethyl-1-(4-fluorophenyl)pyrazole-4-carbonyl]amino]propanoic acid |
| SMILES | CCc1c(C(=O)NCCC(=O)O)cnn1-c1ccc(F)cc1 |
| InChI | InChI=1S/C15H16FN3O3/c1-2-13-12(15(22)17-8-7-14(20)21)9-18-19(13)11-5-3-10(16)4-6-11/h3-6,9H,2,7-8H2,1H3,(H,17,22)(H,20,21) |
| InChIKey | DDTGBUMIYPFHPM-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.31 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |