C14H16FN5O2 — CID 86835872
1-[[5-ethyl-1-(4-fluorophenyl)pyrazole-4-carbonyl]amino]-3-methylurea (PubChem CID 86835872) has the molecular formula C14H16FN5O2 and a molecular weight of 305.31 g/mol. Its IUPAC name is 1-[[5-ethyl-1-(4-fluorophenyl)pyrazole-4-carbonyl]amino]-3-methylurea.
| Compound Name | 1-[[5-ethyl-1-(4-fluorophenyl)pyrazole-4-carbonyl]amino]-3-methylurea |
|---|---|
| PubChem CID | 86835872 |
| Molecular Formula | C14H16FN5O2 |
| Molecular Weight | 305.31 g/mol |
| Exact Mass | 305.13 |
| IUPAC Name | 1-[[5-ethyl-1-(4-fluorophenyl)pyrazole-4-carbonyl]amino]-3-methylurea |
| SMILES | CCc1c(C(=O)NNC(=O)NC)cnn1-c1ccc(F)cc1 |
| InChI | InChI=1S/C14H16FN5O2/c1-3-12-11(13(21)18-19-14(22)16-2)8-17-20(12)10-6-4-9(15)5-7-10/h4-8H,3H2,1-2H3,(H,18,21)(H2,16,19,22) |
| InChIKey | GKFMMVPAJLVHBM-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 88.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.31 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|