C23H23FN6O2 — CID 46589011
1-ethyl-N'-[5-ethyl-1-(4-fluorophenyl)pyrazole-4-carbonyl]-2-methylbenzimidazole-5-carbohydrazide (PubChem CID 46589011) has the molecular formula C23H23FN6O2 and a molecular weight of 434.48 g/mol. Its IUPAC name is 1-ethyl-N'-[5-ethyl-1-(4-fluorophenyl)pyrazole-4-carbonyl]-2-methylbenzimidazole-5-carbohydrazide.
| Compound Name | 1-ethyl-N'-[5-ethyl-1-(4-fluorophenyl)pyrazole-4-carbonyl]-2-methylbenzimidazole-5-carbohydrazide |
|---|---|
| PubChem CID | 46589011 |
| Molecular Formula | C23H23FN6O2 |
| Molecular Weight | 434.48 g/mol |
| Exact Mass | 434.19 |
| IUPAC Name | 1-ethyl-N'-[5-ethyl-1-(4-fluorophenyl)pyrazole-4-carbonyl]-2-methylbenzimidazole-5-carbohydrazide |
| SMILES | CCc1c(C(=O)NNC(=O)c2ccc3c(c2)nc(C)n3CC)cnn1-c1ccc(F)cc1 |
| InChI | InChI=1S/C23H23FN6O2/c1-4-20-18(13-25-30(20)17-9-7-16(24)8-10-17)23(32)28-27-22(31)15-6-11-21-19(12-15)26-14(3)29(21)5-2/h6-13H,4-5H2,1-3H3,(H,27,31)(H,28,32) |
| InChIKey | DMBWQOQAJRTVAX-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 93.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.48 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|