C23H22FN5O3S — CID 24621720
N'-(1-ethyl-2-methylbenzimidazole-5-carbonyl)-2-[(4-fluorophenoxy)methyl]-4-methyl-1,3-thiazole-5-carbohydrazide (PubChem CID 24621720) has the molecular formula C23H22FN5O3S and a molecular weight of 467.53 g/mol. Its IUPAC name is N'-(1-ethyl-2-methylbenzimidazole-5-carbonyl)-2-[(4-fluorophenoxy)methyl]-4-methyl-1,3-thiazole-5-carbohydrazide.
| Compound Name | N'-(1-ethyl-2-methylbenzimidazole-5-carbonyl)-2-[(4-fluorophenoxy)methyl]-4-methyl-1,3-thiazole-5-carbohydrazide |
|---|---|
| PubChem CID | 24621720 |
| Molecular Formula | C23H22FN5O3S |
| Molecular Weight | 467.53 g/mol |
| Exact Mass | 467.14 |
| IUPAC Name | N'-(1-ethyl-2-methylbenzimidazole-5-carbonyl)-2-[(4-fluorophenoxy)methyl]-4-methyl-1,3-thiazole-5-carbohydrazide |
| SMILES | CCn1c(C)nc2cc(C(=O)NNC(=O)c3sc(COc4ccc(F)cc4)nc3C)ccc21 |
| InChI | InChI=1S/C23H22FN5O3S/c1-4-29-14(3)26-18-11-15(5-10-19(18)29)22(30)27-28-23(31)21-13(2)25-20(33-21)12-32-17-8-6-16(24)7-9-17/h5-11H,4,12H2,1-3H3,(H,27,30)(H,28,31) |
| InChIKey | ABZCPICNSGAVOJ-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 98.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.53 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|