C20H16FNO5S — CID 16616472
(4-methoxycarbonylphenyl) 2-[(4-fluorophenoxy)methyl]-4-methyl-1,3-thiazole-5-carboxylate (PubChem CID 16616472) has the molecular formula C20H16FNO5S and a molecular weight of 401.42 g/mol. Its IUPAC name is (4-methoxycarbonylphenyl) 2-[(4-fluorophenoxy)methyl]-4-methyl-1,3-thiazole-5-carboxylate.
| Compound Name | (4-methoxycarbonylphenyl) 2-[(4-fluorophenoxy)methyl]-4-methyl-1,3-thiazole-5-carboxylate |
|---|---|
| PubChem CID | 16616472 |
| Molecular Formula | C20H16FNO5S |
| Molecular Weight | 401.42 g/mol |
| Exact Mass | 401.07 |
| IUPAC Name | (4-methoxycarbonylphenyl) 2-[(4-fluorophenoxy)methyl]-4-methyl-1,3-thiazole-5-carboxylate |
| SMILES | COC(=O)c1ccc(OC(=O)c2sc(COc3ccc(F)cc3)nc2C)cc1 |
| InChI | InChI=1S/C20H16FNO5S/c1-12-18(20(24)27-16-7-3-13(4-8-16)19(23)25-2)28-17(22-12)11-26-15-9-5-14(21)6-10-15/h3-10H,11H2,1-2H3 |
| InChIKey | FHJSGZUECTWJJC-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 74.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.42 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|