C17H22FN3O2 — CID 31889145
N-(3-ethoxypropyl)-5-ethyl-1-(4-fluorophenyl)pyrazole-4-carboxamide (PubChem CID 31889145) has the molecular formula C17H22FN3O2 and a molecular weight of 319.38 g/mol. Its IUPAC name is N-(3-ethoxypropyl)-5-ethyl-1-(4-fluorophenyl)pyrazole-4-carboxamide.
| Compound Name | N-(3-ethoxypropyl)-5-ethyl-1-(4-fluorophenyl)pyrazole-4-carboxamide |
|---|---|
| PubChem CID | 31889145 |
| Molecular Formula | C17H22FN3O2 |
| Molecular Weight | 319.38 g/mol |
| Exact Mass | 319.17 |
| IUPAC Name | N-(3-ethoxypropyl)-5-ethyl-1-(4-fluorophenyl)pyrazole-4-carboxamide |
| SMILES | CCOCCCNC(=O)c1cnn(-c2ccc(F)cc2)c1CC |
| InChI | InChI=1S/C17H22FN3O2/c1-3-16-15(17(22)19-10-5-11-23-4-2)12-20-21(16)14-8-6-13(18)7-9-14/h6-9,12H,3-5,10-11H2,1-2H3,(H,19,22) |
| InChIKey | GUBWECRMVZYYMV-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.38 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|