C22H18F3N5O2 — CID 36759070
N'-[2-(1H-indol-3-yl)acetyl]-1-(4-methylphenyl)-5-(trifluoromethyl)pyrazole-4-carbohydrazide (PubChem CID 36759070) has the molecular formula C22H18F3N5O2 and a molecular weight of 441.41 g/mol. Its IUPAC name is N'-[2-(1H-indol-3-yl)acetyl]-1-(4-methylphenyl)-5-(trifluoromethyl)pyrazole-4-carbohydrazide.
| Compound Name | N'-[2-(1H-indol-3-yl)acetyl]-1-(4-methylphenyl)-5-(trifluoromethyl)pyrazole-4-carbohydrazide |
|---|---|
| PubChem CID | 36759070 |
| Molecular Formula | C22H18F3N5O2 |
| Molecular Weight | 441.41 g/mol |
| Exact Mass | 441.14 |
| IUPAC Name | N'-[2-(1H-indol-3-yl)acetyl]-1-(4-methylphenyl)-5-(trifluoromethyl)pyrazole-4-carbohydrazide |
| SMILES | Cc1ccc(-n2ncc(C(=O)NNC(=O)Cc3c[nH]c4ccccc34)c2C(F)(F)F)cc1 |
| InChI | InChI=1S/C22H18F3N5O2/c1-13-6-8-15(9-7-13)30-20(22(23,24)25)17(12-27-30)21(32)29-28-19(31)10-14-11-26-18-5-3-2-4-16(14)18/h2-9,11-12,26H,10H2,1H3,(H,28,31)(H,29,32) |
| InChIKey | VHEQYTCVCOTVLF-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 91.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.41 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|