C20H18F3N3O3 — CID 18269145
N'-[2-(1H-indol-3-yl)acetyl]-4-(2,2,2-trifluoroethoxymethyl)benzohydrazide (PubChem CID 18269145) has the molecular formula C20H18F3N3O3 and a molecular weight of 405.38 g/mol. Its IUPAC name is N'-[2-(1H-indol-3-yl)acetyl]-4-(2,2,2-trifluoroethoxymethyl)benzohydrazide.
| Compound Name | N'-[2-(1H-indol-3-yl)acetyl]-4-(2,2,2-trifluoroethoxymethyl)benzohydrazide |
|---|---|
| PubChem CID | 18269145 |
| Molecular Formula | C20H18F3N3O3 |
| Molecular Weight | 405.38 g/mol |
| Exact Mass | 405.13 |
| IUPAC Name | N'-[2-(1H-indol-3-yl)acetyl]-4-(2,2,2-trifluoroethoxymethyl)benzohydrazide |
| SMILES | O=C(Cc1c[nH]c2ccccc12)NNC(=O)c1ccc(COCC(F)(F)F)cc1 |
| InChI | InChI=1S/C20H18F3N3O3/c21-20(22,23)12-29-11-13-5-7-14(8-6-13)19(28)26-25-18(27)9-15-10-24-17-4-2-1-3-16(15)17/h1-8,10,24H,9,11-12H2,(H,25,27)(H,26,28) |
| InChIKey | QPICTEKRYUAGRX-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 83.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.38 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|